About N-methyl-2,2-diphenyl-N-[(S)-phenyl(pyrrolidin-1-yl)methyl]acetamide
N-methyl-2,2-diphenyl-N-[(S)-phenyl(pyrrolidin-1-yl)methyl]acetamide (PubChem CID 121357490) has the molecular formula C26H28N2O
and a molecular weight of 384.52 g/mol. Its IUPAC name is N-methyl-2,2-diphenyl-N-[(S)-phenyl(pyrrolidin-1-yl)methyl]acetamide.
Molecular Properties
| Compound Name | N-methyl-2,2-diphenyl-N-[(S)-phenyl(pyrrolidin-1-yl)methyl]acetamide |
| PubChem CID | 121357490 |
| Molecular Formula | C26H28N2O |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N-methyl-2,2-diphenyl-N-[(S)-phenyl(pyrrolidin-1-yl)methyl]acetamide |
| SMILES | CN(C(=O)C(c1ccccc1)c1ccccc1)[C@@H](c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C26H28N2O/c1-27(25(28-19-11-12-20-28)23-17-9-4-10-18-23)26(29)24(21-13-5-2-6-14-21)22-15-7-3-8-16-22/h2-10,13-18,24-25H,11-12,19-20H2,1H3/t25-/m1/s1 |
| InChIKey | DMKIZEYMUAEDLA-RUZDIDTESA-N |
| XLogP | 5.07 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-2,2-diphenyl-N-[(S)-phenyl(pyrrolidin-1-yl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2,2-diphenyl-N-[(S)-phenyl(pyrrolidin-1-yl)methyl]acetamide?
The IUPAC name of N-methyl-2,2-diphenyl-N-[(S)-phenyl(pyrrolidin-1-yl)methyl]acetamide (CID 121357490) is N-methyl-2,2-diphenyl-N-[(S)-phenyl(pyrrolidin-1-yl)methyl]acetamide.
What is the SMILES notation for N-methyl-2,2-diphenyl-N-[(S)-phenyl(pyrrolidin-1-yl)methyl]acetamide?
The canonical SMILES for N-methyl-2,2-diphenyl-N-[(S)-phenyl(pyrrolidin-1-yl)methyl]acetamide is CN(C(=O)C(c1ccccc1)c1ccccc1)[C@@H](c1ccccc1)N1CCCC1.
What is the InChIKey of N-methyl-2,2-diphenyl-N-[(S)-phenyl(pyrrolidin-1-yl)methyl]acetamide?
The InChIKey is DMKIZEYMUAEDLA-RUZDIDTESA-N. The full InChI is InChI=1S/C26H28N2O/c1-27(25(28-19-11-12-20-28)23-17-9-4-10-18-23)26(29)24(21-13-5-2-6-14-21)22-15-7-3-8-16-22/h2-10,13-18,24-25H,11-12,19-20H2,1H3/t25-/m1/s1.
What are the key properties of N-methyl-2,2-diphenyl-N-[(S)-phenyl(pyrrolidin-1-yl)methyl]acetamide?
N-methyl-2,2-diphenyl-N-[(S)-phenyl(pyrrolidin-1-yl)methyl]acetamide has a molecular weight of 384.52 g/mol, XLogP of 5.07, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2,2-diphenyl-N-[(S)-phenyl(pyrrolidin-1-yl)methyl]acetamide is sourced from PubChem (CID 121357490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).