C27H31N3O — CID 121348094
N-[1-(3-aminophenyl)-2-pyrrolidin-1-ylethyl]-N-methyl-2,2-diphenylacetamide (PubChem CID 121348094) has the molecular formula C27H31N3O and a molecular weight of 413.57 g/mol. Its IUPAC name is N-[1-(3-aminophenyl)-2-pyrrolidin-1-ylethyl]-N-methyl-2,2-diphenylacetamide.
| Compound Name | N-[1-(3-aminophenyl)-2-pyrrolidin-1-ylethyl]-N-methyl-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 121348094 |
| Molecular Formula | C27H31N3O |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | N-[1-(3-aminophenyl)-2-pyrrolidin-1-ylethyl]-N-methyl-2,2-diphenylacetamide |
| SMILES | CN(C(=O)C(c1ccccc1)c1ccccc1)C(CN1CCCC1)c1cccc(N)c1 |
| InChI | InChI=1S/C27H31N3O/c1-29(25(20-30-17-8-9-18-30)23-15-10-16-24(28)19-23)27(31)26(21-11-4-2-5-12-21)22-13-6-3-7-14-22/h2-7,10-16,19,25-26H,8-9,17-18,20,28H2,1H3 |
| InChIKey | HTPLSBDQXPSSTD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|