About [1-(3,4-dichlorophenyl)-2-[methyl-(1-phenyl-2-pyrrolidin-1-ylethyl)amino]-2-oxoethyl] acetate
[1-(3,4-dichlorophenyl)-2-[methyl-(1-phenyl-2-pyrrolidin-1-ylethyl)amino]-2-oxoethyl] acetate (PubChem CID 10072390) has the molecular formula C23H26Cl2N2O3
and a molecular weight of 449.38 g/mol. Its IUPAC name is [1-(3,4-dichlorophenyl)-2-[methyl-(1-phenyl-2-pyrrolidin-1-ylethyl)amino]-2-oxoethyl] acetate.
Molecular Properties
| Compound Name | [1-(3,4-dichlorophenyl)-2-[methyl-(1-phenyl-2-pyrrolidin-1-ylethyl)amino]-2-oxoethyl] acetate |
| PubChem CID | 10072390 |
| Molecular Formula | C23H26Cl2N2O3 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | [1-(3,4-dichlorophenyl)-2-[methyl-(1-phenyl-2-pyrrolidin-1-ylethyl)amino]-2-oxoethyl] acetate |
| SMILES | CC(=O)OC(C(=O)N(C)C(CN1CCCC1)c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H26Cl2N2O3/c1-16(28)30-22(18-10-11-19(24)20(25)14-18)23(29)26(2)21(15-27-12-6-7-13-27)17-8-4-3-5-9-17/h3-5,8-11,14,21-22H,6-7,12-13,15H2,1-2H3 |
| InChIKey | JLGNMCHPUKEWHS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(3,4-dichlorophenyl)-2-[methyl-(1-phenyl-2-pyrrolidin-1-ylethyl)amino]-2-oxoethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,4-dichlorophenyl)-2-[methyl-(1-phenyl-2-pyrrolidin-1-ylethyl)amino]-2-oxoethyl] acetate?
The IUPAC name of [1-(3,4-dichlorophenyl)-2-[methyl-(1-phenyl-2-pyrrolidin-1-ylethyl)amino]-2-oxoethyl] acetate (CID 10072390) is [1-(3,4-dichlorophenyl)-2-[methyl-(1-phenyl-2-pyrrolidin-1-ylethyl)amino]-2-oxoethyl] acetate.
What is the SMILES notation for [1-(3,4-dichlorophenyl)-2-[methyl-(1-phenyl-2-pyrrolidin-1-ylethyl)amino]-2-oxoethyl] acetate?
The canonical SMILES for [1-(3,4-dichlorophenyl)-2-[methyl-(1-phenyl-2-pyrrolidin-1-ylethyl)amino]-2-oxoethyl] acetate is CC(=O)OC(C(=O)N(C)C(CN1CCCC1)c1ccccc1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of [1-(3,4-dichlorophenyl)-2-[methyl-(1-phenyl-2-pyrrolidin-1-ylethyl)amino]-2-oxoethyl] acetate?
The InChIKey is JLGNMCHPUKEWHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26Cl2N2O3/c1-16(28)30-22(18-10-11-19(24)20(25)14-18)23(29)26(2)21(15-27-12-6-7-13-27)17-8-4-3-5-9-17/h3-5,8-11,14,21-22H,6-7,12-13,15H2,1-2H3.
What are the key properties of [1-(3,4-dichlorophenyl)-2-[methyl-(1-phenyl-2-pyrrolidin-1-ylethyl)amino]-2-oxoethyl] acetate?
[1-(3,4-dichlorophenyl)-2-[methyl-(1-phenyl-2-pyrrolidin-1-ylethyl)amino]-2-oxoethyl] acetate has a molecular weight of 449.38 g/mol, XLogP of 4.89, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,4-dichlorophenyl)-2-[methyl-(1-phenyl-2-pyrrolidin-1-ylethyl)amino]-2-oxoethyl] acetate is sourced from PubChem (CID 10072390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).