C21H24Cl2N2O2 — CID 18938999
2-(3,4-dichlorophenyl)-N-hydroxy-N-(1-phenyl-2-piperidin-1-ylethyl)acetamide (PubChem CID 18938999) has the molecular formula C21H24Cl2N2O2 and a molecular weight of 407.34 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-hydroxy-N-(1-phenyl-2-piperidin-1-ylethyl)acetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-hydroxy-N-(1-phenyl-2-piperidin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 18938999 |
| Molecular Formula | C21H24Cl2N2O2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-hydroxy-N-(1-phenyl-2-piperidin-1-ylethyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)N(O)C(CN1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C21H24Cl2N2O2/c22-18-10-9-16(13-19(18)23)14-21(26)25(27)20(17-7-3-1-4-8-17)15-24-11-5-2-6-12-24/h1,3-4,7-10,13,20,27H,2,5-6,11-12,14-15H2 |
| InChIKey | IRSRLIBPWZKGKC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|