C20H22Cl2N2O3 — CID 18687590
2-(3,5-dichlorophenyl)-N-hydroxy-N-[2-(3-hydroxypyrrolidin-1-yl)-1-phenylethyl]acetamide (PubChem CID 18687590) has the molecular formula C20H22Cl2N2O3 and a molecular weight of 409.31 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-N-hydroxy-N-[2-(3-hydroxypyrrolidin-1-yl)-1-phenylethyl]acetamide.
| Compound Name | 2-(3,5-dichlorophenyl)-N-hydroxy-N-[2-(3-hydroxypyrrolidin-1-yl)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 18687590 |
| Molecular Formula | C20H22Cl2N2O3 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-N-hydroxy-N-[2-(3-hydroxypyrrolidin-1-yl)-1-phenylethyl]acetamide |
| SMILES | O=C(Cc1cc(Cl)cc(Cl)c1)N(O)C(CN1CCC(O)C1)c1ccccc1 |
| InChI | InChI=1S/C20H22Cl2N2O3/c21-16-8-14(9-17(22)11-16)10-20(26)24(27)19(15-4-2-1-3-5-15)13-23-7-6-18(25)12-23/h1-5,8-9,11,18-19,25,27H,6-7,10,12-13H2 |
| InChIKey | DPUNRQLZXIZDCA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|