C21H21Cl3N2O2 — CID 18939002
N-[2-(3,6-dihydro-2H-pyridin-1-yl)-1-phenylethyl]-N-hydroxy-2-(2,3,6-trichlorophenyl)acetamide (PubChem CID 18939002) has the molecular formula C21H21Cl3N2O2 and a molecular weight of 439.77 g/mol. Its IUPAC name is N-[2-(3,6-dihydro-2H-pyridin-1-yl)-1-phenylethyl]-N-hydroxy-2-(2,3,6-trichlorophenyl)acetamide.
| Compound Name | N-[2-(3,6-dihydro-2H-pyridin-1-yl)-1-phenylethyl]-N-hydroxy-2-(2,3,6-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 18939002 |
| Molecular Formula | C21H21Cl3N2O2 |
| Molecular Weight | 439.77 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | N-[2-(3,6-dihydro-2H-pyridin-1-yl)-1-phenylethyl]-N-hydroxy-2-(2,3,6-trichlorophenyl)acetamide |
| SMILES | O=C(Cc1c(Cl)ccc(Cl)c1Cl)N(O)C(CN1CC=CCC1)c1ccccc1 |
| InChI | InChI=1S/C21H21Cl3N2O2/c22-17-9-10-18(23)21(24)16(17)13-20(27)26(28)19(15-7-3-1-4-8-15)14-25-11-5-2-6-12-25/h1-5,7-10,19,28H,6,11-14H2 |
| InChIKey | KDIGTRXMZSEONY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.77 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|