C26H34Cl2N2O3 — CID 142136685
2-(3,4-dichlorophenyl)-N-[1-[3-(2-hydroxyprop-2-enoxy)phenyl]-2-pyrrolidin-1-ylethyl]-N-methylacetamide;ethane (PubChem CID 142136685) has the molecular formula C26H34Cl2N2O3 and a molecular weight of 493.48 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[1-[3-(2-hydroxyprop-2-enoxy)phenyl]-2-pyrrolidin-1-ylethyl]-N-methylacetamide;ethane.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[1-[3-(2-hydroxyprop-2-enoxy)phenyl]-2-pyrrolidin-1-ylethyl]-N-methylacetamide;ethane |
|---|---|
| PubChem CID | 142136685 |
| Molecular Formula | C26H34Cl2N2O3 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[1-[3-(2-hydroxyprop-2-enoxy)phenyl]-2-pyrrolidin-1-ylethyl]-N-methylacetamide;ethane |
| SMILES | C=C(O)COc1cccc(C(CN2CCCC2)N(C)C(=O)Cc2ccc(Cl)c(Cl)c2)c1.CC |
| InChI | InChI=1S/C24H28Cl2N2O3.C2H6/c1-17(29)16-31-20-7-5-6-19(14-20)23(15-28-10-3-4-11-28)27(2)24(30)13-18-8-9-21(25)22(26)12-18;1-2/h5-9,12,14,23,29H,1,3-4,10-11,13,15-16H2,2H3;1-2H3 |
| InChIKey | AJAXNSASOLFYNX-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|