C21H23Br2Cl2N3O — CID 10393104
N-[(1S)-1-(4-amino-3,5-dibromophenyl)-2-pyrrolidin-1-ylethyl]-2-(3,4-dichlorophenyl)-N-methylacetamide (PubChem CID 10393104) has the molecular formula C21H23Br2Cl2N3O and a molecular weight of 564.15 g/mol. Its IUPAC name is N-[(1S)-1-(4-amino-3,5-dibromophenyl)-2-pyrrolidin-1-ylethyl]-2-(3,4-dichlorophenyl)-N-methylacetamide.
| Compound Name | N-[(1S)-1-(4-amino-3,5-dibromophenyl)-2-pyrrolidin-1-ylethyl]-2-(3,4-dichlorophenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 10393104 |
| Molecular Formula | C21H23Br2Cl2N3O |
| Molecular Weight | 564.15 g/mol |
| Exact Mass | 560.96 |
| IUPAC Name | N-[(1S)-1-(4-amino-3,5-dibromophenyl)-2-pyrrolidin-1-ylethyl]-2-(3,4-dichlorophenyl)-N-methylacetamide |
| SMILES | CN(C(=O)Cc1ccc(Cl)c(Cl)c1)[C@H](CN1CCCC1)c1cc(Br)c(N)c(Br)c1 |
| InChI | InChI=1S/C21H23Br2Cl2N3O/c1-27(20(29)9-13-4-5-17(24)18(25)8-13)19(12-28-6-2-3-7-28)14-10-15(22)21(26)16(23)11-14/h4-5,8,10-11,19H,2-3,6-7,9,12,26H2,1H3/t19-/m1/s1 |
| InChIKey | FLVYRMKOYFQWOD-LJQANCHMSA-N |
| XLogP | 5.94 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.15 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|