C24H31Cl2N3O6 — CID 146176724
2-(3,4-dichlorophenyl)-N-[1-[4-(2-methoxyperoxyperoxyethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-N-methylacetamide (PubChem CID 146176724) has the molecular formula C24H31Cl2N3O6 and a molecular weight of 528.43 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[1-[4-(2-methoxyperoxyperoxyethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-N-methylacetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[1-[4-(2-methoxyperoxyperoxyethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 146176724 |
| Molecular Formula | C24H31Cl2N3O6 |
| Molecular Weight | 528.43 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[1-[4-(2-methoxyperoxyperoxyethylamino)phenyl]-2-pyrrolidin-1-ylethyl]-N-methylacetamide |
| SMILES | COOOOOCCNc1ccc(C(CN2CCCC2)N(C)C(=O)Cc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H31Cl2N3O6/c1-28(24(30)16-18-5-10-21(25)22(26)15-18)23(17-29-12-3-4-13-29)19-6-8-20(9-7-19)27-11-14-32-34-35-33-31-2/h5-10,15,23,27H,3-4,11-14,16-17H2,1-2H3 |
| InChIKey | QANVNALJMTUXCZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 81.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|