C25H27Cl2N3O4 — CID 54191176
4-[4,5-dichloro-2-[2-[methyl-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]amino]-2-oxoethyl]anilino]-4-oxobut-2-enoic acid (PubChem CID 54191176) has the molecular formula C25H27Cl2N3O4 and a molecular weight of 504.41 g/mol. Its IUPAC name is 4-[4,5-dichloro-2-[2-[methyl-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]amino]-2-oxoethyl]anilino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[4,5-dichloro-2-[2-[methyl-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]amino]-2-oxoethyl]anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 54191176 |
| Molecular Formula | C25H27Cl2N3O4 |
| Molecular Weight | 504.41 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | 4-[4,5-dichloro-2-[2-[methyl-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]amino]-2-oxoethyl]anilino]-4-oxobut-2-enoic acid |
| SMILES | CN(C(=O)Cc1cc(Cl)c(Cl)cc1NC(=O)C=CC(=O)O)[C@H](CN1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C25H27Cl2N3O4/c1-29(22(16-30-11-5-6-12-30)17-7-3-2-4-8-17)24(32)14-18-13-19(26)20(27)15-21(18)28-23(31)9-10-25(33)34/h2-4,7-10,13,15,22H,5-6,11-12,14,16H2,1H3,(H,28,31)(H,33,34)/t22-/m1/s1 |
| InChIKey | PIPYVPXNBBEVDP-JOCHJYFZSA-N |
| XLogP | 4.41 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|