C23H33N3O6S2 — CID 10229395
2-[2-(methanesulfonamido)phenyl]-N-methyl-N-[(1R)-1-phenyl-2-pyrrolidin-1-ylethyl]acetamide;methanesulfonic acid (PubChem CID 10229395) has the molecular formula C23H33N3O6S2 and a molecular weight of 511.67 g/mol. Its IUPAC name is 2-[2-(methanesulfonamido)phenyl]-N-methyl-N-[(1R)-1-phenyl-2-pyrrolidin-1-ylethyl]acetamide;methanesulfonic acid.
| Compound Name | 2-[2-(methanesulfonamido)phenyl]-N-methyl-N-[(1R)-1-phenyl-2-pyrrolidin-1-ylethyl]acetamide;methanesulfonic acid |
|---|---|
| PubChem CID | 10229395 |
| Molecular Formula | C23H33N3O6S2 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | 2-[2-(methanesulfonamido)phenyl]-N-methyl-N-[(1R)-1-phenyl-2-pyrrolidin-1-ylethyl]acetamide;methanesulfonic acid |
| SMILES | CN(C(=O)Cc1ccccc1NS(C)(=O)=O)[C@@H](CN1CCCC1)c1ccccc1.CS(=O)(=O)O |
| InChI | InChI=1S/C22H29N3O3S.CH4O3S/c1-24(21(17-25-14-8-9-15-25)18-10-4-3-5-11-18)22(26)16-19-12-6-7-13-20(19)23-29(2,27)28;1-5(2,3)4/h3-7,10-13,21,23H,8-9,14-17H2,1-2H3;1H3,(H,2,3,4)/t21-;/m0./s1 |
| InChIKey | JQFIYAFWOOPJEJ-BOXHHOBZSA-N |
| XLogP | 2.40 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|