C23H28N2O2S — CID 158181130
2-(1-benzofuran-4-yl)-N-methyl-N-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]acetamide;sulfane (PubChem CID 158181130) has the molecular formula C23H28N2O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is 2-(1-benzofuran-4-yl)-N-methyl-N-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]acetamide;sulfane.
| Compound Name | 2-(1-benzofuran-4-yl)-N-methyl-N-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]acetamide;sulfane |
|---|---|
| PubChem CID | 158181130 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 2-(1-benzofuran-4-yl)-N-methyl-N-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]acetamide;sulfane |
| SMILES | CN(C(=O)Cc1cccc2occc12)[C@H](CN1CCCC1)c1ccccc1.S |
| InChI | InChI=1S/C23H26N2O2.H2S/c1-24(23(26)16-19-10-7-11-22-20(19)12-15-27-22)21(17-25-13-5-6-14-25)18-8-3-2-4-9-18;/h2-4,7-12,15,21H,5-6,13-14,16-17H2,1H3;1H2/t21-;/m1./s1 |
| InChIKey | FYPLNVUPNGVDSX-ZMBIFBSDSA-N |
| XLogP | 4.38 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |