C29H33N3O8 — CID 10120098
(Z)-5-(2-aminophenyl)-6-[methyl-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]amino]-4,6-dioxohex-2-enoic acid;(Z)-but-2-enedioic acid (PubChem CID 10120098) has the molecular formula C29H33N3O8 and a molecular weight of 551.60 g/mol. Its IUPAC name is (Z)-5-(2-aminophenyl)-6-[methyl-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]amino]-4,6-dioxohex-2-enoic acid;(Z)-but-2-enedioic acid.
| Compound Name | (Z)-5-(2-aminophenyl)-6-[methyl-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]amino]-4,6-dioxohex-2-enoic acid;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 10120098 |
| Molecular Formula | C29H33N3O8 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | (Z)-5-(2-aminophenyl)-6-[methyl-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]amino]-4,6-dioxohex-2-enoic acid;(Z)-but-2-enedioic acid |
| SMILES | CN(C(=O)C(C(=O)/C=C\C(=O)O)c1ccccc1N)[C@H](CN1CCCC1)c1ccccc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C25H29N3O4.C4H4O4/c1-27(21(17-28-15-7-8-16-28)18-9-3-2-4-10-18)25(32)24(22(29)13-14-23(30)31)19-11-5-6-12-20(19)26;5-3(6)1-2-4(7)8/h2-6,9-14,21,24H,7-8,15-17,26H2,1H3,(H,30,31);1-2H,(H,5,6)(H,7,8)/b14-13-;2-1-/t21-,24?;/m1./s1 |
| InChIKey | JWYXNTBOMQOSGH-CNBCUUDUSA-N |
| XLogP | 2.57 |
| TPSA | 178.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|