C27H30ClNO2 — CID 86127745
(2-phenyl-2-piperidin-1-ylethyl) 2,2-diphenylacetate;hydrochloride (PubChem CID 86127745) has the molecular formula C27H30ClNO2 and a molecular weight of 436.00 g/mol. Its IUPAC name is (2-phenyl-2-piperidin-1-ylethyl) 2,2-diphenylacetate;hydrochloride.
| Compound Name | (2-phenyl-2-piperidin-1-ylethyl) 2,2-diphenylacetate;hydrochloride |
|---|---|
| PubChem CID | 86127745 |
| Molecular Formula | C27H30ClNO2 |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | (2-phenyl-2-piperidin-1-ylethyl) 2,2-diphenylacetate;hydrochloride |
| SMILES | Cl.O=C(OCC(c1ccccc1)N1CCCCC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29NO2.ClH/c29-27(26(23-15-7-2-8-16-23)24-17-9-3-10-18-24)30-21-25(22-13-5-1-6-14-22)28-19-11-4-12-20-28;/h1-3,5-10,13-18,25-26H,4,11-12,19-21H2;1H |
| InChIKey | QLSLEVBNBCJVSL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |