About (2-phenyl-2-pyrrolidin-1-ylethyl) 4-aminobenzoate;hydrochloride
(2-phenyl-2-pyrrolidin-1-ylethyl) 4-aminobenzoate;hydrochloride (PubChem CID 24845460) has the molecular formula C19H23ClN2O2
and a molecular weight of 346.86 g/mol. Its IUPAC name is (2-phenyl-2-pyrrolidin-1-ylethyl) 4-aminobenzoate;hydrochloride.
Molecular Properties
| Compound Name | (2-phenyl-2-pyrrolidin-1-ylethyl) 4-aminobenzoate;hydrochloride |
| PubChem CID | 24845460 |
| Molecular Formula | C19H23ClN2O2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (2-phenyl-2-pyrrolidin-1-ylethyl) 4-aminobenzoate;hydrochloride |
| SMILES | Cl.Nc1ccc(C(=O)OCC(c2ccccc2)N2CCCC2)cc1 |
| InChI | InChI=1S/C19H22N2O2.ClH/c20-17-10-8-16(9-11-17)19(22)23-14-18(21-12-4-5-13-21)15-6-2-1-3-7-15;/h1-3,6-11,18H,4-5,12-14,20H2;1H |
| InChIKey | FBBLXEPFPUYCLA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2-phenyl-2-pyrrolidin-1-ylethyl) 4-aminobenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenyl-2-pyrrolidin-1-ylethyl) 4-aminobenzoate;hydrochloride?
The IUPAC name of (2-phenyl-2-pyrrolidin-1-ylethyl) 4-aminobenzoate;hydrochloride (CID 24845460) is (2-phenyl-2-pyrrolidin-1-ylethyl) 4-aminobenzoate;hydrochloride.
What is the SMILES notation for (2-phenyl-2-pyrrolidin-1-ylethyl) 4-aminobenzoate;hydrochloride?
The canonical SMILES for (2-phenyl-2-pyrrolidin-1-ylethyl) 4-aminobenzoate;hydrochloride is Cl.Nc1ccc(C(=O)OCC(c2ccccc2)N2CCCC2)cc1.
What is the InChIKey of (2-phenyl-2-pyrrolidin-1-ylethyl) 4-aminobenzoate;hydrochloride?
The InChIKey is FBBLXEPFPUYCLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O2.ClH/c20-17-10-8-16(9-11-17)19(22)23-14-18(21-12-4-5-13-21)15-6-2-1-3-7-15;/h1-3,6-11,18H,4-5,12-14,20H2;1H.
What are the key properties of (2-phenyl-2-pyrrolidin-1-ylethyl) 4-aminobenzoate;hydrochloride?
(2-phenyl-2-pyrrolidin-1-ylethyl) 4-aminobenzoate;hydrochloride has a molecular weight of 346.86 g/mol, XLogP of 3.68, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenyl-2-pyrrolidin-1-ylethyl) 4-aminobenzoate;hydrochloride is sourced from PubChem (CID 24845460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).