C18H23NO — CID 67314826
N,N-dimethyl-2,2-diphenylacetamide;ethane (PubChem CID 67314826) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is N,N-dimethyl-2,2-diphenylacetamide;ethane.
| Compound Name | N,N-dimethyl-2,2-diphenylacetamide;ethane |
|---|---|
| PubChem CID | 67314826 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | N,N-dimethyl-2,2-diphenylacetamide;ethane |
| SMILES | CC.CN(C)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO.C2H6/c1-17(2)16(18)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;1-2/h3-12,15H,1-2H3;1-2H3 |
| InChIKey | WSRJXFCFVXYQER-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |