C12H17NO4 — CID 134855963
(2S,3R,4S)-2,3,4-trihydroxy-N,N-dimethyl-4-phenylbutanamide (PubChem CID 134855963) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is (2S,3R,4S)-2,3,4-trihydroxy-N,N-dimethyl-4-phenylbutanamide.
| Compound Name | (2S,3R,4S)-2,3,4-trihydroxy-N,N-dimethyl-4-phenylbutanamide |
|---|---|
| PubChem CID | 134855963 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | (2S,3R,4S)-2,3,4-trihydroxy-N,N-dimethyl-4-phenylbutanamide |
| SMILES | CN(C)C(=O)[C@@H](O)[C@H](O)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C12H17NO4/c1-13(2)12(17)11(16)10(15)9(14)8-6-4-3-5-7-8/h3-7,9-11,14-16H,1-2H3/t9-,10+,11-/m0/s1 |
| InChIKey | USFNJPFQPFAMKJ-AXFHLTTASA-N |
| XLogP | -0.47 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |