C14H19NO2 — CID 12682146
2-[hydroxy(phenyl)methyl]-N,N,3-trimethylbut-3-enamide (PubChem CID 12682146) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-[hydroxy(phenyl)methyl]-N,N,3-trimethylbut-3-enamide.
| Compound Name | 2-[hydroxy(phenyl)methyl]-N,N,3-trimethylbut-3-enamide |
|---|---|
| PubChem CID | 12682146 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2-[hydroxy(phenyl)methyl]-N,N,3-trimethylbut-3-enamide |
| SMILES | C=C(C)C(C(=O)N(C)C)C(O)c1ccccc1 |
| InChI | InChI=1S/C14H19NO2/c1-10(2)12(14(17)15(3)4)13(16)11-8-6-5-7-9-11/h5-9,12-13,16H,1H2,2-4H3 |
| InChIKey | SQJZXRMAWBLKLK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|