C13H17NO3 — CID 102469609
(1-hydroxy-1-phenylbut-3-en-2-yl) N,N-dimethylcarbamate (PubChem CID 102469609) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is (1-hydroxy-1-phenylbut-3-en-2-yl) N,N-dimethylcarbamate.
| Compound Name | (1-hydroxy-1-phenylbut-3-en-2-yl) N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 102469609 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (1-hydroxy-1-phenylbut-3-en-2-yl) N,N-dimethylcarbamate |
| SMILES | C=CC(OC(=O)N(C)C)C(O)c1ccccc1 |
| InChI | InChI=1S/C13H17NO3/c1-4-11(17-13(16)14(2)3)12(15)10-8-6-5-7-9-10/h4-9,11-12,15H,1H2,2-3H3 |
| InChIKey | HGVYTWSAWWIOJZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|