C16H23NO2 — CID 118867301
(2R)-N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,2-dimethylpent-4-enamide (PubChem CID 118867301) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is (2R)-N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,2-dimethylpent-4-enamide.
| Compound Name | (2R)-N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,2-dimethylpent-4-enamide |
|---|---|
| PubChem CID | 118867301 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (2R)-N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,2-dimethylpent-4-enamide |
| SMILES | C=CC[C@@H](C)C(=O)N(C)[C@@H](C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H23NO2/c1-5-9-12(2)16(19)17(4)13(3)15(18)14-10-7-6-8-11-14/h5-8,10-13,15,18H,1,9H2,2-4H3/t12-,13+,15+/m1/s1 |
| InChIKey | SVSKBMAZSMFIKZ-IPYPFGDCSA-N |
| XLogP | 2.78 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|