C25H33NO2 — CID 102384838
(2S,3R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-phenyl-2-prop-2-enylhexanamide (PubChem CID 102384838) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is (2S,3R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-phenyl-2-prop-2-enylhexanamide.
| Compound Name | (2S,3R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-phenyl-2-prop-2-enylhexanamide |
|---|---|
| PubChem CID | 102384838 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | (2S,3R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-phenyl-2-prop-2-enylhexanamide |
| SMILES | C=CC[C@H](C(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1)[C@@H](CCC)c1ccccc1 |
| InChI | InChI=1S/C25H33NO2/c1-5-13-22(20-15-9-7-10-16-20)23(14-6-2)25(28)26(4)19(3)24(27)21-17-11-8-12-18-21/h6-12,15-19,22-24,27H,2,5,13-14H2,1,3-4H3/t19-,22-,23-,24+/m0/s1 |
| InChIKey | DHCOHBWQVOTHDI-ZNEWLNCYSA-N |
| XLogP | 5.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|