C24H31NO5 — CID 100985394
(2S)-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-(3,4,5-trimethoxyphenyl)pent-4-enamide (PubChem CID 100985394) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is (2S)-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-(3,4,5-trimethoxyphenyl)pent-4-enamide.
| Compound Name | (2S)-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-(3,4,5-trimethoxyphenyl)pent-4-enamide |
|---|---|
| PubChem CID | 100985394 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | (2S)-N-[(1R,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-(3,4,5-trimethoxyphenyl)pent-4-enamide |
| SMILES | C=CC[C@H](C(=O)N(C)[C@H](C)[C@H](O)c1ccccc1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C24H31NO5/c1-7-11-19(18-14-20(28-4)23(30-6)21(15-18)29-5)24(27)25(3)16(2)22(26)17-12-9-8-10-13-17/h7-10,12-16,19,22,26H,1,11H2,2-6H3/t16-,19+,22+/m1/s1 |
| InChIKey | XPJFSAJEXFQIKQ-WVBUVRCRSA-N |
| XLogP | 3.95 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|