C22H26O6 — CID 100985396
(2S)-1-(3,4-dimethoxyphenyl)-2-(3,4,5-trimethoxyphenyl)pent-4-en-1-one (PubChem CID 100985396) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is (2S)-1-(3,4-dimethoxyphenyl)-2-(3,4,5-trimethoxyphenyl)pent-4-en-1-one.
| Compound Name | (2S)-1-(3,4-dimethoxyphenyl)-2-(3,4,5-trimethoxyphenyl)pent-4-en-1-one |
|---|---|
| PubChem CID | 100985396 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (2S)-1-(3,4-dimethoxyphenyl)-2-(3,4,5-trimethoxyphenyl)pent-4-en-1-one |
| SMILES | C=CC[C@H](C(=O)c1ccc(OC)c(OC)c1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H26O6/c1-7-8-16(15-12-19(26-4)22(28-6)20(13-15)27-5)21(23)14-9-10-17(24-2)18(11-14)25-3/h7,9-13,16H,1,8H2,2-6H3/t16-/m0/s1 |
| InChIKey | TZZLXHAVSAFETG-INIZCTEOSA-N |
| XLogP | 4.27 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|