C21H27NO5 — CID 10981602
1,2-bis(3,4-dimethoxyphenyl)-3-(dimethylamino)propan-1-one (PubChem CID 10981602) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is 1,2-bis(3,4-dimethoxyphenyl)-3-(dimethylamino)propan-1-one.
| Compound Name | 1,2-bis(3,4-dimethoxyphenyl)-3-(dimethylamino)propan-1-one |
|---|---|
| PubChem CID | 10981602 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 1,2-bis(3,4-dimethoxyphenyl)-3-(dimethylamino)propan-1-one |
| SMILES | COc1ccc(C(=O)C(CN(C)C)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C21H27NO5/c1-22(2)13-16(14-7-9-17(24-3)19(11-14)26-5)21(23)15-8-10-18(25-4)20(12-15)27-6/h7-12,16H,13H2,1-6H3 |
| InChIKey | NUKXFISFWAQJDA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |