C18H20NNaO4 — CID 140821135
sodium 4-[(1R)-2-(dimethylamino)-1-phenylethoxy]-3-methoxybenzoate (PubChem CID 140821135) has the molecular formula C18H20NNaO4 and a molecular weight of 337.35 g/mol. Its IUPAC name is sodium 4-[(1R)-2-(dimethylamino)-1-phenylethoxy]-3-methoxybenzoate.
| Compound Name | sodium 4-[(1R)-2-(dimethylamino)-1-phenylethoxy]-3-methoxybenzoate |
|---|---|
| PubChem CID | 140821135 |
| Molecular Formula | C18H20NNaO4 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | sodium 4-[(1R)-2-(dimethylamino)-1-phenylethoxy]-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)[O-])ccc1O[C@@H](CN(C)C)c1ccccc1.[Na+] |
| InChI | InChI=1S/C18H21NO4.Na/c1-19(2)12-17(13-7-5-4-6-8-13)23-15-10-9-14(18(20)21)11-16(15)22-3;/h4-11,17H,12H2,1-3H3,(H,20,21);/q;+1/p-1/t17-;/m0./s1 |
| InChIKey | UERSGKQJEPCHMH-LMOVPXPDSA-M |
| XLogP | -1.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |