C26H29NO4 — CID 121407741
2-[4-[(1R)-3-(dimethylamino)-1-phenylpropoxy]-3-methoxyphenyl]-2-hydroxy-1-phenylethanone (PubChem CID 121407741) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is 2-[4-[(1R)-3-(dimethylamino)-1-phenylpropoxy]-3-methoxyphenyl]-2-hydroxy-1-phenylethanone.
| Compound Name | 2-[4-[(1R)-3-(dimethylamino)-1-phenylpropoxy]-3-methoxyphenyl]-2-hydroxy-1-phenylethanone |
|---|---|
| PubChem CID | 121407741 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 2-[4-[(1R)-3-(dimethylamino)-1-phenylpropoxy]-3-methoxyphenyl]-2-hydroxy-1-phenylethanone |
| SMILES | COc1cc(C(O)C(=O)c2ccccc2)ccc1O[C@H](CCN(C)C)c1ccccc1 |
| InChI | InChI=1S/C26H29NO4/c1-27(2)17-16-22(19-10-6-4-7-11-19)31-23-15-14-21(18-24(23)30-3)26(29)25(28)20-12-8-5-9-13-20/h4-15,18,22,26,29H,16-17H2,1-3H3/t22-,26?/m1/s1 |
| InChIKey | WRZBBUBRKKUAOC-FPSALIRRSA-N |
| XLogP | 4.68 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |