C22H27NO5 — CID 12807425
N,N-dimethyl-3-phenyl-3-(2-prop-2-enylphenoxy)propan-1-amine;oxalic acid (PubChem CID 12807425) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is N,N-dimethyl-3-phenyl-3-(2-prop-2-enylphenoxy)propan-1-amine;oxalic acid.
| Compound Name | N,N-dimethyl-3-phenyl-3-(2-prop-2-enylphenoxy)propan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 12807425 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N,N-dimethyl-3-phenyl-3-(2-prop-2-enylphenoxy)propan-1-amine;oxalic acid |
| SMILES | C=CCc1ccccc1OC(CCN(C)C)c1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H25NO.C2H2O4/c1-4-10-17-13-8-9-14-19(17)22-20(15-16-21(2)3)18-11-6-5-7-12-18;3-1(4)2(5)6/h4-9,11-14,20H,1,10,15-16H2,2-3H3;(H,3,4)(H,5,6) |
| InChIKey | RDSDZZYGNBOEQS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|