C19H23NO4 — CID 138687817
[3-[2-(2-hydroxyethyl)phenoxy]-3-phenylpropyl]-methylcarbamic acid (PubChem CID 138687817) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is [3-[2-(2-hydroxyethyl)phenoxy]-3-phenylpropyl]-methylcarbamic acid.
| Compound Name | [3-[2-(2-hydroxyethyl)phenoxy]-3-phenylpropyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 138687817 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | [3-[2-(2-hydroxyethyl)phenoxy]-3-phenylpropyl]-methylcarbamic acid |
| SMILES | CN(CCC(Oc1ccccc1CCO)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H23NO4/c1-20(19(22)23)13-11-18(15-7-3-2-4-8-15)24-17-10-6-5-9-16(17)12-14-21/h2-10,18,21H,11-14H2,1H3,(H,22,23) |
| InChIKey | YMUYURIHLLPHRQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |