C22H29NO4 — CID 142700885
tert-butyl N-[(3R)-3-(2-methoxyphenoxy)-3-phenylpropyl]-N-methylcarbamate (PubChem CID 142700885) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is tert-butyl N-[(3R)-3-(2-methoxyphenoxy)-3-phenylpropyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(3R)-3-(2-methoxyphenoxy)-3-phenylpropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 142700885 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | tert-butyl N-[(3R)-3-(2-methoxyphenoxy)-3-phenylpropyl]-N-methylcarbamate |
| SMILES | COc1ccccc1O[C@H](CCN(C)C(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H29NO4/c1-22(2,3)27-21(24)23(4)16-15-18(17-11-7-6-8-12-17)26-20-14-10-9-13-19(20)25-5/h6-14,18H,15-16H2,1-5H3/t18-/m1/s1 |
| InChIKey | TUKIFQPGGASHBC-GOSISDBHSA-N |
| XLogP | 5.07 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |