C29H34N2O4 — CID 151258384
tert-butyl N-[3-[3-[benzoyl(methyl)amino]phenoxy]-3-phenylpropyl]-N-methylcarbamate (PubChem CID 151258384) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[benzoyl(methyl)amino]phenoxy]-3-phenylpropyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[3-[benzoyl(methyl)amino]phenoxy]-3-phenylpropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 151258384 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | tert-butyl N-[3-[3-[benzoyl(methyl)amino]phenoxy]-3-phenylpropyl]-N-methylcarbamate |
| SMILES | CN(CCC(Oc1cccc(N(C)C(=O)c2ccccc2)c1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H34N2O4/c1-29(2,3)35-28(33)30(4)20-19-26(22-13-8-6-9-14-22)34-25-18-12-17-24(21-25)31(5)27(32)23-15-10-7-11-16-23/h6-18,21,26H,19-20H2,1-5H3 |
| InChIKey | NTVIDBYYIUFIKD-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |