C19H24BrNO3S — CID 138724165
tert-butyl N-[(3S)-3-(2-bromophenoxy)-3-thiophen-2-ylpropyl]-N-methylcarbamate (PubChem CID 138724165) has the molecular formula C19H24BrNO3S and a molecular weight of 426.38 g/mol. Its IUPAC name is tert-butyl N-[(3S)-3-(2-bromophenoxy)-3-thiophen-2-ylpropyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(3S)-3-(2-bromophenoxy)-3-thiophen-2-ylpropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 138724165 |
| Molecular Formula | C19H24BrNO3S |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | tert-butyl N-[(3S)-3-(2-bromophenoxy)-3-thiophen-2-ylpropyl]-N-methylcarbamate |
| SMILES | CN(CC[C@H](Oc1ccccc1Br)c1cccs1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H24BrNO3S/c1-19(2,3)24-18(22)21(4)12-11-16(17-10-7-13-25-17)23-15-9-6-5-8-14(15)20/h5-10,13,16H,11-12H2,1-4H3/t16-/m0/s1 |
| InChIKey | WEPPFYVOOVIZME-INIZCTEOSA-N |
| XLogP | 5.89 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |