C22H23NO4S — CID 86278283
4-[methyl-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]amino]-4-oxobutanoic acid (PubChem CID 86278283) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is 4-[methyl-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[methyl-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 86278283 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 4-[methyl-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]amino]-4-oxobutanoic acid |
| SMILES | CN(CC[C@H](Oc1cccc2ccccc12)c1cccs1)C(=O)CCC(=O)O |
| InChI | InChI=1S/C22H23NO4S/c1-23(21(24)11-12-22(25)26)14-13-19(20-10-5-15-28-20)27-18-9-4-7-16-6-2-3-8-17(16)18/h2-10,15,19H,11-14H2,1H3,(H,25,26)/t19-/m0/s1 |
| InChIKey | AJLVEKJDKWHFDD-IBGZPJMESA-N |
| XLogP | 4.73 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |