C23H31NO2S — CID 144673562
ethane;N-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]acetamide (PubChem CID 144673562) has the molecular formula C23H31NO2S and a molecular weight of 385.57 g/mol. Its IUPAC name is ethane;N-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]acetamide.
| Compound Name | ethane;N-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]acetamide |
|---|---|
| PubChem CID | 144673562 |
| Molecular Formula | C23H31NO2S |
| Molecular Weight | 385.57 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | ethane;N-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]acetamide |
| SMILES | CC.CC.CC(=O)NCC[C@H](Oc1cccc2ccccc12)c1cccs1 |
| InChI | InChI=1S/C19H19NO2S.2C2H6/c1-14(21)20-12-11-18(19-10-5-13-23-19)22-17-9-4-7-15-6-2-3-8-16(15)17;2*1-2/h2-10,13,18H,11-12H2,1H3,(H,20,21);2*1-2H3/t18-;;/m0../s1 |
| InChIKey | CQPLJASWSIPCOT-NTEVMMBTSA-N |
| XLogP | 6.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.57 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |