C37H36N2O3S2 — CID 54756197
1,3-dimethyl-1,3-bis(3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl)urea (PubChem CID 54756197) has the molecular formula C37H36N2O3S2 and a molecular weight of 620.84 g/mol. Its IUPAC name is 1,3-dimethyl-1,3-bis(3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl)urea.
| Compound Name | 1,3-dimethyl-1,3-bis(3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl)urea |
|---|---|
| PubChem CID | 54756197 |
| Molecular Formula | C37H36N2O3S2 |
| Molecular Weight | 620.84 g/mol |
| Exact Mass | 620.22 |
| IUPAC Name | 1,3-dimethyl-1,3-bis(3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl)urea |
| SMILES | CN(CCC(Oc1cccc2ccccc12)c1cccs1)C(=O)N(C)CCC(Oc1cccc2ccccc12)c1cccs1 |
| InChI | InChI=1S/C37H36N2O3S2/c1-38(23-21-33(35-19-9-25-43-35)41-31-17-7-13-27-11-3-5-15-29(27)31)37(40)39(2)24-22-34(36-20-10-26-44-36)42-32-18-8-14-28-12-4-6-16-30(28)32/h3-20,25-26,33-34H,21-24H2,1-2H3 |
| InChIKey | ZSJIFEJPTIPXDB-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.84 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |