C40H40N2O6S2 — CID 68591935
bis[(1S,3S)-1-(dimethylamino)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl] oxalate (PubChem CID 68591935) has the molecular formula C40H40N2O6S2 and a molecular weight of 708.90 g/mol. Its IUPAC name is bis[(1S,3S)-1-(dimethylamino)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl] oxalate.
| Compound Name | bis[(1S,3S)-1-(dimethylamino)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl] oxalate |
|---|---|
| PubChem CID | 68591935 |
| Molecular Formula | C40H40N2O6S2 |
| Molecular Weight | 708.90 g/mol |
| Exact Mass | 708.23 |
| IUPAC Name | bis[(1S,3S)-1-(dimethylamino)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl] oxalate |
| SMILES | CN(C)[C@H](C[C@H](Oc1cccc2ccccc12)c1cccs1)OC(=O)C(=O)O[C@@H](C[C@H](Oc1cccc2ccccc12)c1cccs1)N(C)C |
| InChI | InChI=1S/C40H40N2O6S2/c1-41(2)37(25-33(35-21-11-23-49-35)45-31-19-9-15-27-13-5-7-17-29(27)31)47-39(43)40(44)48-38(42(3)4)26-34(36-22-12-24-50-36)46-32-20-10-16-28-14-6-8-18-30(28)32/h5-24,33-34,37-38H,25-26H2,1-4H3/t33-,34-,37-,38-/m0/s1 |
| InChIKey | CBHASISLLBGDSB-JOJDORDVSA-N |
| XLogP | 8.70 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.90 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|