C40H38N2O6S2 — CID 68915328
bis[1-(methylamino)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl] (E)-but-2-enedioate (PubChem CID 68915328) has the molecular formula C40H38N2O6S2 and a molecular weight of 706.89 g/mol. Its IUPAC name is bis[1-(methylamino)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl] (E)-but-2-enedioate.
| Compound Name | bis[1-(methylamino)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 68915328 |
| Molecular Formula | C40H38N2O6S2 |
| Molecular Weight | 706.89 g/mol |
| Exact Mass | 706.22 |
| IUPAC Name | bis[1-(methylamino)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl] (E)-but-2-enedioate |
| SMILES | CNC(CC(Oc1cccc2ccccc12)c1cccs1)OC(=O)/C=C/C(=O)OC(CC(Oc1cccc2ccccc12)c1cccs1)NC |
| InChI | InChI=1S/C40H38N2O6S2/c1-41-37(25-33(35-19-9-23-49-35)45-31-17-7-13-27-11-3-5-15-29(27)31)47-39(43)21-22-40(44)48-38(42-2)26-34(36-20-10-24-50-36)46-32-18-8-14-28-12-4-6-16-30(28)32/h3-24,33-34,37-38,41-42H,25-26H2,1-2H3/b22-21+ |
| InChIKey | XPIHWEIEUIXSKS-QURGRASLSA-N |
| XLogP | 8.57 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.89 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|