C20H23NO3S — CID 67283492
acetic acid;(3S)-N-methyl-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine (PubChem CID 67283492) has the molecular formula C20H23NO3S and a molecular weight of 357.48 g/mol. Its IUPAC name is acetic acid;(3S)-N-methyl-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine.
| Compound Name | acetic acid;(3S)-N-methyl-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 67283492 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | acetic acid;(3S)-N-methyl-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine |
| SMILES | CC(=O)O.CNCC[C@H](Oc1cccc2ccccc12)c1cccs1 |
| InChI | InChI=1S/C18H19NOS.C2H4O2/c1-19-12-11-17(18-10-5-13-21-18)20-16-9-4-7-14-6-2-3-8-15(14)16;1-2(3)4/h2-10,13,17,19H,11-12H2,1H3;1H3,(H,3,4)/t17-;/m0./s1 |
| InChIKey | GTZQCRLKBPAYKN-LMOVPXPDSA-N |
| XLogP | 4.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |