C17H18N2O2S — CID 135145361
N-methyl-3-(2-oxidoisoquinolin-2-ium-5-yl)oxy-3-thiophen-2-ylpropan-1-amine (PubChem CID 135145361) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is N-methyl-3-(2-oxidoisoquinolin-2-ium-5-yl)oxy-3-thiophen-2-ylpropan-1-amine.
| Compound Name | N-methyl-3-(2-oxidoisoquinolin-2-ium-5-yl)oxy-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 135145361 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-methyl-3-(2-oxidoisoquinolin-2-ium-5-yl)oxy-3-thiophen-2-ylpropan-1-amine |
| SMILES | CNCCC(Oc1cccc2c[n+]([O-])ccc12)c1cccs1 |
| InChI | InChI=1S/C17H18N2O2S/c1-18-9-7-16(17-6-3-11-22-17)21-15-5-2-4-13-12-19(20)10-8-14(13)15/h2-6,8,10-12,16,18H,7,9H2,1H3 |
| InChIKey | YSQUOOUQLDSCFX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 48.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|