C18H19NOS — CID 46781438
3-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)oxy-N-methyl-3-thiophen-2-ylpropan-1-amine (PubChem CID 46781438) has the molecular formula C18H19NOS and a molecular weight of 304.47 g/mol. Its IUPAC name is 3-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)oxy-N-methyl-3-thiophen-2-ylpropan-1-amine.
| Compound Name | 3-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)oxy-N-methyl-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 46781438 |
| Molecular Formula | C18H19NOS |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 3-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)oxy-N-methyl-3-thiophen-2-ylpropan-1-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(OC(CCNC)c3cccs3)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C18H19NOS/c1-19-12-11-17(18-10-5-13-21-18)20-16-9-4-7-14-6-2-3-8-15(14)16/h2-10,13,17,19H,11-12H2,1H3/i2D,3D,4D,6D,7D,8D,9D |
| InChIKey | ZEUITGRIYCTCEM-GHYOIDBVSA-N |
| XLogP | 4.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |