C17H24N2OS — CID 138738146
N-methyl-3-[2-[2-(methylamino)ethyl]phenoxy]-3-thiophen-2-ylpropan-1-amine (PubChem CID 138738146) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is N-methyl-3-[2-[2-(methylamino)ethyl]phenoxy]-3-thiophen-2-ylpropan-1-amine.
| Compound Name | N-methyl-3-[2-[2-(methylamino)ethyl]phenoxy]-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 138738146 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-methyl-3-[2-[2-(methylamino)ethyl]phenoxy]-3-thiophen-2-ylpropan-1-amine |
| SMILES | CNCCc1ccccc1OC(CCNC)c1cccs1 |
| InChI | InChI=1S/C17H24N2OS/c1-18-11-9-14-6-3-4-7-15(14)20-16(10-12-19-2)17-8-5-13-21-17/h3-8,13,16,18-19H,9-12H2,1-2H3 |
| InChIKey | OTIAUHUSKRRWSM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |