C25H33NOS — CID 58879412
3-(2,3,4,5,6,7,8-heptamethylnaphthalen-1-yl)oxy-N-methyl-3-thiophen-2-ylpropan-1-amine (PubChem CID 58879412) has the molecular formula C25H33NOS and a molecular weight of 395.61 g/mol. Its IUPAC name is 3-(2,3,4,5,6,7,8-heptamethylnaphthalen-1-yl)oxy-N-methyl-3-thiophen-2-ylpropan-1-amine.
| Compound Name | 3-(2,3,4,5,6,7,8-heptamethylnaphthalen-1-yl)oxy-N-methyl-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 58879412 |
| Molecular Formula | C25H33NOS |
| Molecular Weight | 395.61 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 3-(2,3,4,5,6,7,8-heptamethylnaphthalen-1-yl)oxy-N-methyl-3-thiophen-2-ylpropan-1-amine |
| SMILES | CNCCC(Oc1c(C)c(C)c(C)c2c(C)c(C)c(C)c(C)c12)c1cccs1 |
| InChI | InChI=1S/C25H33NOS/c1-14-15(2)19(6)24-23(17(14)4)18(5)16(3)20(7)25(24)27-21(11-12-26-8)22-10-9-13-28-22/h9-10,13,21,26H,11-12H2,1-8H3 |
| InChIKey | YAVFVDLFWYGPGI-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.61 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |