C19H27NOS — CID 146420156
N-methyl-3-[4-(2-methylbutyl)phenoxy]-3-thiophen-2-ylpropan-1-amine (PubChem CID 146420156) has the molecular formula C19H27NOS and a molecular weight of 317.50 g/mol. Its IUPAC name is N-methyl-3-[4-(2-methylbutyl)phenoxy]-3-thiophen-2-ylpropan-1-amine.
| Compound Name | N-methyl-3-[4-(2-methylbutyl)phenoxy]-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 146420156 |
| Molecular Formula | C19H27NOS |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | N-methyl-3-[4-(2-methylbutyl)phenoxy]-3-thiophen-2-ylpropan-1-amine |
| SMILES | CCC(C)Cc1ccc(OC(CCNC)c2cccs2)cc1 |
| InChI | InChI=1S/C19H27NOS/c1-4-15(2)14-16-7-9-17(10-8-16)21-18(11-12-20-3)19-6-5-13-22-19/h5-10,13,15,18,20H,4,11-12,14H2,1-3H3 |
| InChIKey | YYZNIWCCLCWLGH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |