C20H28N2OS — CID 137371830
(3R)-N-methyl-3-[3-(1-methylpiperidin-4-yl)phenoxy]-3-thiophen-2-ylpropan-1-amine (PubChem CID 137371830) has the molecular formula C20H28N2OS and a molecular weight of 344.52 g/mol. Its IUPAC name is (3R)-N-methyl-3-[3-(1-methylpiperidin-4-yl)phenoxy]-3-thiophen-2-ylpropan-1-amine.
| Compound Name | (3R)-N-methyl-3-[3-(1-methylpiperidin-4-yl)phenoxy]-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 137371830 |
| Molecular Formula | C20H28N2OS |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (3R)-N-methyl-3-[3-(1-methylpiperidin-4-yl)phenoxy]-3-thiophen-2-ylpropan-1-amine |
| SMILES | CNCC[C@@H](Oc1cccc(C2CCN(C)CC2)c1)c1cccs1 |
| InChI | InChI=1S/C20H28N2OS/c1-21-11-8-19(20-7-4-14-24-20)23-18-6-3-5-17(15-18)16-9-12-22(2)13-10-16/h3-7,14-16,19,21H,8-13H2,1-2H3/t19-/m1/s1 |
| InChIKey | LSKXMOULVRIZNI-LJQANCHMSA-N |
| XLogP | 4.29 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |