C26H32N2O2S — CID 138560347
3-[1-[[3-[3-(methylamino)-1-thiophen-2-ylpropoxy]phenyl]methyl]piperidin-4-yl]phenol (PubChem CID 138560347) has the molecular formula C26H32N2O2S and a molecular weight of 436.62 g/mol. Its IUPAC name is 3-[1-[[3-[3-(methylamino)-1-thiophen-2-ylpropoxy]phenyl]methyl]piperidin-4-yl]phenol.
| Compound Name | 3-[1-[[3-[3-(methylamino)-1-thiophen-2-ylpropoxy]phenyl]methyl]piperidin-4-yl]phenol |
|---|---|
| PubChem CID | 138560347 |
| Molecular Formula | C26H32N2O2S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 3-[1-[[3-[3-(methylamino)-1-thiophen-2-ylpropoxy]phenyl]methyl]piperidin-4-yl]phenol |
| SMILES | CNCCC(Oc1cccc(CN2CCC(c3cccc(O)c3)CC2)c1)c1cccs1 |
| InChI | InChI=1S/C26H32N2O2S/c1-27-13-10-25(26-9-4-16-31-26)30-24-8-2-5-20(17-24)19-28-14-11-21(12-15-28)22-6-3-7-23(29)18-22/h2-9,16-18,21,25,27,29H,10-15,19H2,1H3 |
| InChIKey | CJROKYAMXKWOQP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |