C25H32N4O2S — CID 166843967
1,8-dimethyl-4-[[4-[3-(methylamino)-1-thiophen-2-ylpropoxy]phenyl]methyl]-2,3,8,9-tetrahydropyrido[2,3-e][1,4]diazepin-5-one (PubChem CID 166843967) has the molecular formula C25H32N4O2S and a molecular weight of 452.62 g/mol. Its IUPAC name is 1,8-dimethyl-4-[[4-[3-(methylamino)-1-thiophen-2-ylpropoxy]phenyl]methyl]-2,3,8,9-tetrahydropyrido[2,3-e][1,4]diazepin-5-one.
| Compound Name | 1,8-dimethyl-4-[[4-[3-(methylamino)-1-thiophen-2-ylpropoxy]phenyl]methyl]-2,3,8,9-tetrahydropyrido[2,3-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 166843967 |
| Molecular Formula | C25H32N4O2S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 1,8-dimethyl-4-[[4-[3-(methylamino)-1-thiophen-2-ylpropoxy]phenyl]methyl]-2,3,8,9-tetrahydropyrido[2,3-e][1,4]diazepin-5-one |
| SMILES | CNCCC(Oc1ccc(CN2CCN(C)C3=C(C=CC(C)N3)C2=O)cc1)c1cccs1 |
| InChI | InChI=1S/C25H32N4O2S/c1-18-6-11-21-24(27-18)28(3)14-15-29(25(21)30)17-19-7-9-20(10-8-19)31-22(12-13-26-2)23-5-4-16-32-23/h4-11,16,18,22,26-27H,12-15,17H2,1-3H3 |
| InChIKey | WFVHAKRXGFUVOC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |