C18H19NO2S — CID 71748970
2,3,5,6,7,8-hexadeuterio-4-[(1S)-3-(methylamino)-1-thiophen-2-ylpropoxy]naphthalen-1-ol (PubChem CID 71748970) has the molecular formula C18H19NO2S and a molecular weight of 319.46 g/mol. Its IUPAC name is 2,3,5,6,7,8-hexadeuterio-4-[(1S)-3-(methylamino)-1-thiophen-2-ylpropoxy]naphthalen-1-ol.
| Compound Name | 2,3,5,6,7,8-hexadeuterio-4-[(1S)-3-(methylamino)-1-thiophen-2-ylpropoxy]naphthalen-1-ol |
|---|---|
| PubChem CID | 71748970 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 319.46 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2,3,5,6,7,8-hexadeuterio-4-[(1S)-3-(methylamino)-1-thiophen-2-ylpropoxy]naphthalen-1-ol |
| SMILES | [2H]c1c([2H])c([2H])c2c(O[C@@H](CCNC)c3cccs3)c([2H])c([2H])c(O)c2c1[2H] |
| InChI | InChI=1S/C18H19NO2S/c1-19-11-10-17(18-7-4-12-22-18)21-16-9-8-15(20)13-5-2-3-6-14(13)16/h2-9,12,17,19-20H,10-11H2,1H3/t17-/m0/s1/i2D,3D,5D,6D,8D,9D |
| InChIKey | DRRXQCXSBONKPD-DFLASTFQSA-N |
| XLogP | 4.34 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |