C12H16O4 — CID 107711645
(3S)-3-[2-(2-hydroxyethyl)phenoxy]butanoic acid (PubChem CID 107711645) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (3S)-3-[2-(2-hydroxyethyl)phenoxy]butanoic acid.
| Compound Name | (3S)-3-[2-(2-hydroxyethyl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 107711645 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (3S)-3-[2-(2-hydroxyethyl)phenoxy]butanoic acid |
| SMILES | C[C@@H](CC(=O)O)Oc1ccccc1CCO |
| InChI | InChI=1S/C12H16O4/c1-9(8-12(14)15)16-11-5-3-2-4-10(11)6-7-13/h2-5,9,13H,6-8H2,1H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | OJGUZPGLAXLXJW-VIFPVBQESA-N |
| XLogP | 1.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |