C15H20O2 — CID 101163130
(4S)-4-[(R)-hydroxy(phenyl)methyl]-2-methylhept-6-en-3-one (PubChem CID 101163130) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (4S)-4-[(R)-hydroxy(phenyl)methyl]-2-methylhept-6-en-3-one.
| Compound Name | (4S)-4-[(R)-hydroxy(phenyl)methyl]-2-methylhept-6-en-3-one |
|---|---|
| PubChem CID | 101163130 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (4S)-4-[(R)-hydroxy(phenyl)methyl]-2-methylhept-6-en-3-one |
| SMILES | C=CC[C@H](C(=O)C(C)C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C15H20O2/c1-4-8-13(14(16)11(2)3)15(17)12-9-6-5-7-10-12/h4-7,9-11,13,15,17H,1,8H2,2-3H3/t13-,15+/m1/s1 |
| InChIKey | MTLILGAUDAPNLM-HIFRSBDPSA-N |
| XLogP | 3.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|