C12H16O — CID 129363226
(2S,3R)-3-phenylhex-5-en-2-ol (PubChem CID 129363226) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is (2S,3R)-3-phenylhex-5-en-2-ol.
| Compound Name | (2S,3R)-3-phenylhex-5-en-2-ol |
|---|---|
| PubChem CID | 129363226 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (2S,3R)-3-phenylhex-5-en-2-ol |
| SMILES | C=CC[C@H](c1ccccc1)[C@H](C)O |
| InChI | InChI=1S/C12H16O/c1-3-7-12(10(2)13)11-8-5-4-6-9-11/h3-6,8-10,12-13H,1,7H2,2H3/t10-,12-/m0/s1 |
| InChIKey | GZHVHEZCHNQOAR-JQWIXIFHSA-N |
| XLogP | 2.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|