C24H23NO — CID 2794125
N-(1,2-diphenylpent-4-enyl)benzamide (PubChem CID 2794125) has the molecular formula C24H23NO and a molecular weight of 341.45 g/mol. Its IUPAC name is N-(1,2-diphenylpent-4-enyl)benzamide.
| Compound Name | N-(1,2-diphenylpent-4-enyl)benzamide |
|---|---|
| PubChem CID | 2794125 |
| Molecular Formula | C24H23NO |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | N-(1,2-diphenylpent-4-enyl)benzamide |
| SMILES | C=CCC(c1ccccc1)C(NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23NO/c1-2-12-22(19-13-6-3-7-14-19)23(20-15-8-4-9-16-20)25-24(26)21-17-10-5-11-18-21/h2-11,13-18,22-23H,1,12H2,(H,25,26) |
| InChIKey | AHDVSODJVWDBOP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|